About 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine
5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine (PubChem CID 134424612) has the molecular formula C8H8FN
and a molecular weight of 137.16 g/mol. Its IUPAC name is 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine.
Analyze 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine?
The IUPAC name of 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine (CID 134424612) is 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine.
What is the SMILES notation for 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine?
The canonical SMILES for 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine is CNC1=C=CC=C(F)C=C1.
What is the InChIKey of 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine?
The InChIKey is SZVGIIYPWKCXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN/c1-10-8-4-2-3-7(9)5-6-8/h2-3,5-6,10H,1H3.
What are the key properties of 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine?
5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine has a molecular weight of 137.16 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-methylcyclohepta-1,2,4,6-tetraen-1-amine is sourced from PubChem (CID 134424612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).