About CID 13442627
CID 13442627 (PubChem CID 13442627) has the molecular formula C36H66PbSn
and a molecular weight of 824.83 g/mol.
Molecular Properties
| Compound Name | CID 13442627 |
| PubChem CID | 13442627 |
| Molecular Formula | C36H66PbSn |
| Molecular Weight | 824.83 g/mol |
| Exact Mass | 826.40 |
| IUPAC Name | — |
| SMILES | C1CCC([Pb](C2CCCCC2)C2CCCCC2)CC1.C1CCC([Sn](C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/6C6H11.Pb.Sn/c6*1-2-4-6-5-3-1;;/h6*1H,2-6H2;; |
| InChIKey | BDRHMJSRYGJFMB-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 824.83 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 13442627 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13442627?
The IUPAC name of CID 13442627 (CID 13442627) is not available.
What is the SMILES notation for CID 13442627?
The canonical SMILES for CID 13442627 is C1CCC([Pb](C2CCCCC2)C2CCCCC2)CC1.C1CCC([Sn](C2CCCCC2)C2CCCCC2)CC1.
What is the InChIKey of CID 13442627?
The InChIKey is BDRHMJSRYGJFMB-UHFFFAOYSA-N. The full InChI is InChI=1S/6C6H11.Pb.Sn/c6*1-2-4-6-5-3-1;;/h6*1H,2-6H2;;.
What are the key properties of CID 13442627?
CID 13442627 has a molecular weight of 824.83 g/mol, XLogP of 12.97, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13442627 is sourced from PubChem (CID 13442627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).