C17H28Cl2N2O4 — CID 134438268
tert-butyl N-[(3S)-7,7-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-bicyclo[4.1.0]heptanyl]carbamate (PubChem CID 134438268) has the molecular formula C17H28Cl2N2O4 and a molecular weight of 395.33 g/mol. Its IUPAC name is tert-butyl N-[(3S)-7,7-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-bicyclo[4.1.0]heptanyl]carbamate.
| Compound Name | tert-butyl N-[(3S)-7,7-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-bicyclo[4.1.0]heptanyl]carbamate |
|---|---|
| PubChem CID | 134438268 |
| Molecular Formula | C17H28Cl2N2O4 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | tert-butyl N-[(3S)-7,7-dichloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-bicyclo[4.1.0]heptanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC2C(C[C@@H]1NC(=O)OC(C)(C)C)C2(Cl)Cl |
| InChI | InChI=1S/C17H28Cl2N2O4/c1-15(2,3)24-13(22)20-11-7-9-10(17(9,18)19)8-12(11)21-14(23)25-16(4,5)6/h9-12H,7-8H2,1-6H3,(H,20,22)(H,21,23)/t9?,10?,11-,12?/m0/s1 |
| InChIKey | FGKPSEBNJPCWMP-FYJQFVIDSA-N |
| XLogP | 3.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|