C13H9N3S2 — CID 134439544
2-[2-(1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]prop-2-enenitrile (PubChem CID 134439544) has the molecular formula C13H9N3S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]prop-2-enenitrile.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 134439544 |
| Molecular Formula | C13H9N3S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazol-4-yl]prop-2-enenitrile |
| SMILES | C=C(C#N)C1CSC(c2nc3ccccc3s2)=N1 |
| InChI | InChI=1S/C13H9N3S2/c1-8(6-14)10-7-17-12(16-10)13-15-9-4-2-3-5-11(9)18-13/h2-5,10H,1,7H2 |
| InChIKey | CCPJWSKSRRJHRR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|