C15H18N4OS2 — CID 155282722
N'-methyl-2-(6-propan-2-yl-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carbohydrazide (PubChem CID 155282722) has the molecular formula C15H18N4OS2 and a molecular weight of 334.47 g/mol. Its IUPAC name is N'-methyl-2-(6-propan-2-yl-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-methyl-2-(6-propan-2-yl-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 155282722 |
| Molecular Formula | C15H18N4OS2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N'-methyl-2-(6-propan-2-yl-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carbohydrazide |
| SMILES | CNNC(=O)C1CSC(c2nc3ccc(C(C)C)cc3s2)=N1 |
| InChI | InChI=1S/C15H18N4OS2/c1-8(2)9-4-5-10-12(6-9)22-15(17-10)14-18-11(7-21-14)13(20)19-16-3/h4-6,8,11,16H,7H2,1-3H3,(H,19,20) |
| InChIKey | FGKNAUQVTUMRNC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|