C25H25FN4O5S — CID 134442418
3-[(2S)-2-[9a-(4-fluorophenyl)sulfonyl-3-oxo-2,5,6,6a,8,9-hexahydropyrrolo[2,3-h]isoquinoline-7-carbonyl]-5-oxopyrrolidin-1-yl]propanenitrile (PubChem CID 134442418) has the molecular formula C25H25FN4O5S and a molecular weight of 512.56 g/mol. Its IUPAC name is 3-[(2S)-2-[9a-(4-fluorophenyl)sulfonyl-3-oxo-2,5,6,6a,8,9-hexahydropyrrolo[2,3-h]isoquinoline-7-carbonyl]-5-oxopyrrolidin-1-yl]propanenitrile.
| Compound Name | 3-[(2S)-2-[9a-(4-fluorophenyl)sulfonyl-3-oxo-2,5,6,6a,8,9-hexahydropyrrolo[2,3-h]isoquinoline-7-carbonyl]-5-oxopyrrolidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 134442418 |
| Molecular Formula | C25H25FN4O5S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 3-[(2S)-2-[9a-(4-fluorophenyl)sulfonyl-3-oxo-2,5,6,6a,8,9-hexahydropyrrolo[2,3-h]isoquinoline-7-carbonyl]-5-oxopyrrolidin-1-yl]propanenitrile |
| SMILES | N#CCCN1C(=O)CC[C@H]1C(=O)N1CCC2(S(=O)(=O)c3ccc(F)cc3)c3c[nH]c(=O)cc3CCC12 |
| InChI | InChI=1S/C25H25FN4O5S/c26-17-3-5-18(6-4-17)36(34,35)25-10-13-30(21(25)8-2-16-14-22(31)28-15-19(16)25)24(33)20-7-9-23(32)29(20)12-1-11-27/h3-6,14-15,20-21H,1-2,7-10,12-13H2,(H,28,31)/t20-,21?,25?/m0/s1 |
| InChIKey | CRQYVBNEYUUKGV-LQAIBEDLSA-N |
| XLogP | 1.63 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |