C28H43NO2 — CID 134444453
(6aS,6bS,9S,11aS,11bR)-9-[(2S,3R,5S)-2,5-dimethylpiperidin-3-yl]oxy-9-ethyl-10,11b-dimethyl-1,2,5,6,6a,6b,7,8,11,11a-decahydrobenzo[a]fluoren-3-one (PubChem CID 134444453) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is (6aS,6bS,9S,11aS,11bR)-9-[(2S,3R,5S)-2,5-dimethylpiperidin-3-yl]oxy-9-ethyl-10,11b-dimethyl-1,2,5,6,6a,6b,7,8,11,11a-decahydrobenzo[a]fluoren-3-one.
| Compound Name | (6aS,6bS,9S,11aS,11bR)-9-[(2S,3R,5S)-2,5-dimethylpiperidin-3-yl]oxy-9-ethyl-10,11b-dimethyl-1,2,5,6,6a,6b,7,8,11,11a-decahydrobenzo[a]fluoren-3-one |
|---|---|
| PubChem CID | 134444453 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | (6aS,6bS,9S,11aS,11bR)-9-[(2S,3R,5S)-2,5-dimethylpiperidin-3-yl]oxy-9-ethyl-10,11b-dimethyl-1,2,5,6,6a,6b,7,8,11,11a-decahydrobenzo[a]fluoren-3-one |
| SMILES | CC[C@]1(O[C@@H]2C[C@H](C)CN[C@H]2C)CC[C@@H]2C(=C1C)C[C@H]1[C@H]2CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C28H43NO2/c1-6-28(31-26-13-17(2)16-29-19(26)4)12-10-22-23-8-7-20-14-21(30)9-11-27(20,5)25(23)15-24(22)18(28)3/h14,17,19,22-23,25-26,29H,6-13,15-16H2,1-5H3/t17-,19-,22-,23-,25-,26+,27-,28-/m0/s1 |
| InChIKey | QRNHDPKXRXZPTF-RWHCOFTDSA-N |
| XLogP | 5.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|