C25H30F4N6 — CID 134453570
6-[(6S)-8,8-dimethyl-7-(2,2,2-trifluoroethyl)-6,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine (PubChem CID 134453570) has the molecular formula C25H30F4N6 and a molecular weight of 490.55 g/mol. Its IUPAC name is 6-[(6S)-8,8-dimethyl-7-(2,2,2-trifluoroethyl)-6,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine.
| Compound Name | 6-[(6S)-8,8-dimethyl-7-(2,2,2-trifluoroethyl)-6,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 134453570 |
| Molecular Formula | C25H30F4N6 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 6-[(6S)-8,8-dimethyl-7-(2,2,2-trifluoroethyl)-6,9-dihydro-3H-pyrazolo[4,5-f]isoquinolin-6-yl]-N-[1-(3-fluoropropyl)azetidin-3-yl]pyridin-3-amine |
| SMILES | CC1(C)Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C25H30F4N6/c1-24(2)10-19-18(5-7-21-20(19)12-31-33-21)23(35(24)15-25(27,28)29)22-6-4-16(11-30-22)32-17-13-34(14-17)9-3-8-26/h4-7,11-12,17,23,32H,3,8-10,13-15H2,1-2H3,(H,31,33)/t23-/m0/s1 |
| InChIKey | QIMVRHMVKAJIDE-QHCPKHFHSA-N |
| XLogP | 4.70 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |