C18H22BrFN4O4S2 — CID 134459152
2-[[(1S,2S)-2-[2-bromo-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]cyclohexyl]amino]ethyl formate (PubChem CID 134459152) has the molecular formula C18H22BrFN4O4S2 and a molecular weight of 521.43 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-[2-bromo-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]cyclohexyl]amino]ethyl formate.
| Compound Name | 2-[[(1S,2S)-2-[2-bromo-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]cyclohexyl]amino]ethyl formate |
|---|---|
| PubChem CID | 134459152 |
| Molecular Formula | C18H22BrFN4O4S2 |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | 2-[[(1S,2S)-2-[2-bromo-5-fluoro-4-(1,3-thiazol-2-ylsulfamoyl)anilino]cyclohexyl]amino]ethyl formate |
| SMILES | O=COCCN[C@H]1CCCC[C@@H]1Nc1cc(F)c(S(=O)(=O)Nc2nccs2)cc1Br |
| InChI | InChI=1S/C18H22BrFN4O4S2/c19-12-9-17(30(26,27)24-18-22-6-8-29-18)13(20)10-16(12)23-15-4-2-1-3-14(15)21-5-7-28-11-25/h6,8-11,14-15,21,23H,1-5,7H2,(H,22,24)/t14-,15-/m0/s1 |
| InChIKey | DQTYGNUVXQVSMG-GJZGRUSLSA-N |
| XLogP | 3.33 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|