C18H15BrF2N2O3S2 — CID 134459398
5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2,4-difluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide (PubChem CID 134459398) has the molecular formula C18H15BrF2N2O3S2 and a molecular weight of 489.36 g/mol. Its IUPAC name is 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2,4-difluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide.
| Compound Name | 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2,4-difluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide |
|---|---|
| PubChem CID | 134459398 |
| Molecular Formula | C18H15BrF2N2O3S2 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 5-bromo-N-[(2,4-dimethoxyphenyl)methyl]-2,4-difluoro-N-(1,3-thiazol-2-yl)benzenesulfinamide |
| SMILES | COc1ccc(CN(c2nccs2)S(=O)c2cc(Br)c(F)cc2F)c(OC)c1 |
| InChI | InChI=1S/C18H15BrF2N2O3S2/c1-25-12-4-3-11(16(7-12)26-2)10-23(18-22-5-6-27-18)28(24)17-8-13(19)14(20)9-15(17)21/h3-9H,10H2,1-2H3 |
| InChIKey | WCIUFULFFPDRRR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|