C18H17ClFN3O2S2 — CID 134458849
N-(4-amino-5-chloro-2-fluorophenyl)sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 134458849) has the molecular formula C18H17ClFN3O2S2 and a molecular weight of 425.94 g/mol. Its IUPAC name is N-(4-amino-5-chloro-2-fluorophenyl)sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-(4-amino-5-chloro-2-fluorophenyl)sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 134458849 |
| Molecular Formula | C18H17ClFN3O2S2 |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | N-(4-amino-5-chloro-2-fluorophenyl)sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(CN(Sc2cc(Cl)c(N)cc2F)c2nccs2)c(OC)c1 |
| InChI | InChI=1S/C18H17ClFN3O2S2/c1-24-12-4-3-11(16(7-12)25-2)10-23(18-22-5-6-26-18)27-17-8-13(19)15(21)9-14(17)20/h3-9H,10,21H2,1-2H3 |
| InChIKey | JSWKASVJYZKKDQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|