C20H18ClF2N3O2S — CID 134602106
N-(5-chloro-2,4-difluorophenyl)sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-6-methylpyrimidin-4-amine (PubChem CID 134602106) has the molecular formula C20H18ClF2N3O2S and a molecular weight of 437.90 g/mol. Its IUPAC name is N-(5-chloro-2,4-difluorophenyl)sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-6-methylpyrimidin-4-amine.
| Compound Name | N-(5-chloro-2,4-difluorophenyl)sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 134602106 |
| Molecular Formula | C20H18ClF2N3O2S |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N-(5-chloro-2,4-difluorophenyl)sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-6-methylpyrimidin-4-amine |
| SMILES | COc1ccc(CN(Sc2cc(Cl)c(F)cc2F)c2cc(C)ncn2)c(OC)c1 |
| InChI | InChI=1S/C20H18ClF2N3O2S/c1-12-6-20(25-11-24-12)26(29-19-8-15(21)16(22)9-17(19)23)10-13-4-5-14(27-2)7-18(13)28-3/h4-9,11H,10H2,1-3H3 |
| InChIKey | FYJLJIMUDNYVQW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|