C18H16ClFN4O2S — CID 153367521
N-[(6-chloro-5-fluoro-3-pyridinyl)sulfanyl]-N-[(2,4-dimethoxyphenyl)methyl]pyrimidin-4-amine (PubChem CID 153367521) has the molecular formula C18H16ClFN4O2S and a molecular weight of 406.87 g/mol. Its IUPAC name is N-[(6-chloro-5-fluoro-3-pyridinyl)sulfanyl]-N-[(2,4-dimethoxyphenyl)methyl]pyrimidin-4-amine.
| Compound Name | N-[(6-chloro-5-fluoro-3-pyridinyl)sulfanyl]-N-[(2,4-dimethoxyphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 153367521 |
| Molecular Formula | C18H16ClFN4O2S |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | N-[(6-chloro-5-fluoro-3-pyridinyl)sulfanyl]-N-[(2,4-dimethoxyphenyl)methyl]pyrimidin-4-amine |
| SMILES | COc1ccc(CN(Sc2cnc(Cl)c(F)c2)c2ccncn2)c(OC)c1 |
| InChI | InChI=1S/C18H16ClFN4O2S/c1-25-13-4-3-12(16(7-13)26-2)10-24(17-5-6-21-11-23-17)27-14-8-15(20)18(19)22-9-14/h3-9,11H,10H2,1-2H3 |
| InChIKey | KPVDRHAOYBYTMV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|