C28H24ClFN4O2S2 — CID 134602295
N-[5-chloro-2-fluoro-4-(isoquinolin-8-ylmethylamino)phenyl]sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 134602295) has the molecular formula C28H24ClFN4O2S2 and a molecular weight of 567.11 g/mol. Its IUPAC name is N-[5-chloro-2-fluoro-4-(isoquinolin-8-ylmethylamino)phenyl]sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[5-chloro-2-fluoro-4-(isoquinolin-8-ylmethylamino)phenyl]sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 134602295 |
| Molecular Formula | C28H24ClFN4O2S2 |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | N-[5-chloro-2-fluoro-4-(isoquinolin-8-ylmethylamino)phenyl]sulfanyl-N-[(2,4-dimethoxyphenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(CN(Sc2cc(Cl)c(NCc3cccc4ccncc34)cc2F)c2nccs2)c(OC)c1 |
| InChI | InChI=1S/C28H24ClFN4O2S2/c1-35-21-7-6-20(26(12-21)36-2)17-34(28-32-10-11-37-28)38-27-13-23(29)25(14-24(27)30)33-15-19-5-3-4-18-8-9-31-16-22(18)19/h3-14,16,33H,15,17H2,1-2H3 |
| InChIKey | PEZLAZDLEOVAFX-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|