C28H38ClFN4O5S2 — CID 145335598
tert-butyl N-[2-chloro-4-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-5-fluorophenyl]-N-(4-hydroxybutyl)carbamate;ethane (PubChem CID 145335598) has the molecular formula C28H38ClFN4O5S2 and a molecular weight of 629.22 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-4-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-5-fluorophenyl]-N-(4-hydroxybutyl)carbamate;ethane.
| Compound Name | tert-butyl N-[2-chloro-4-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-5-fluorophenyl]-N-(4-hydroxybutyl)carbamate;ethane |
|---|---|
| PubChem CID | 145335598 |
| Molecular Formula | C28H38ClFN4O5S2 |
| Molecular Weight | 629.22 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | tert-butyl N-[2-chloro-4-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-5-fluorophenyl]-N-(4-hydroxybutyl)carbamate;ethane |
| SMILES | CC.COc1ccc(CN(Sc2cc(Cl)c(N(CCCCO)C(=O)OC(C)(C)C)cc2F)c2ncns2)c(OC)c1 |
| InChI | InChI=1S/C26H32ClFN4O5S2.C2H6/c1-26(2,3)37-25(34)31(10-6-7-11-33)21-14-20(28)23(13-19(21)27)39-32(24-29-16-30-38-24)15-17-8-9-18(35-4)12-22(17)36-5;1-2/h8-9,12-14,16,33H,6-7,10-11,15H2,1-5H3;1-2H3 |
| InChIKey | DHPPEFDIFGFJNG-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.22 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|