C20H21N3O4S2 — CID 145285378
7-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 145285378) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 7-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 7-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 145285378 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 7-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc(CN(Sc2ccc3c(c2)OCCC3O)c2ncns2)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O4S2/c1-25-14-4-3-13(18(9-14)26-2)11-23(20-21-12-22-28-20)29-15-5-6-16-17(24)7-8-27-19(16)10-15/h3-6,9-10,12,17,24H,7-8,11H2,1-2H3 |
| InChIKey | QTGFVXWVPKDHFA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|