C20H21N3O3S3 — CID 145285299
7-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-3,4-dihydro-2H-chromene-4-thiol (PubChem CID 145285299) has the molecular formula C20H21N3O3S3 and a molecular weight of 447.61 g/mol. Its IUPAC name is 7-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-3,4-dihydro-2H-chromene-4-thiol.
| Compound Name | 7-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-3,4-dihydro-2H-chromene-4-thiol |
|---|---|
| PubChem CID | 145285299 |
| Molecular Formula | C20H21N3O3S3 |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 7-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)amino]sulfanyl-3,4-dihydro-2H-chromene-4-thiol |
| SMILES | COc1ccc(CN(Sc2ccc3c(c2)OCCC3S)c2ncns2)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O3S3/c1-24-14-4-3-13(17(9-14)25-2)11-23(20-21-12-22-28-20)29-15-5-6-16-18(10-15)26-8-7-19(16)27/h3-6,9-10,12,19,27H,7-8,11H2,1-2H3 |
| InChIKey | TVYYIXFXOPJING-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|