C11H18F3NO4 — CID 134459498
[(2-methylpropan-2-yl)oxycarbonylamino]methyl 2-(trifluoromethyl)butanoate (PubChem CID 134459498) has the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonylamino]methyl 2-(trifluoromethyl)butanoate.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonylamino]methyl 2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 134459498 |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonylamino]methyl 2-(trifluoromethyl)butanoate |
| SMILES | CCC(C(=O)OCNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO4/c1-5-7(11(12,13)14)8(16)18-6-15-9(17)19-10(2,3)4/h7H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | NGVJKKFKQMPELS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|