C14H8Cl2FN3O3 — CID 134459971
3-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]-4-fluoro-N-hydroxybenzamide (PubChem CID 134459971) has the molecular formula C14H8Cl2FN3O3 and a molecular weight of 356.14 g/mol. Its IUPAC name is 3-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]-4-fluoro-N-hydroxybenzamide.
| Compound Name | 3-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]-4-fluoro-N-hydroxybenzamide |
|---|---|
| PubChem CID | 134459971 |
| Molecular Formula | C14H8Cl2FN3O3 |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-[(5,6-dichloro-1,3-benzoxazol-2-yl)amino]-4-fluoro-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(F)c(Nc2nc3cc(Cl)c(Cl)cc3o2)c1 |
| InChI | InChI=1S/C14H8Cl2FN3O3/c15-7-4-11-12(5-8(7)16)23-14(19-11)18-10-3-6(13(21)20-22)1-2-9(10)17/h1-5,22H,(H,18,19)(H,20,21) |
| InChIKey | GTFPHNVFCJNXBA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|