C21H18ClN3O4 — CID 134462045
ethyl (Z)-4-(3-chloroanilino)oxy-2-methylidene-3-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pent-4-enoate (PubChem CID 134462045) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is ethyl (Z)-4-(3-chloroanilino)oxy-2-methylidene-3-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pent-4-enoate.
| Compound Name | ethyl (Z)-4-(3-chloroanilino)oxy-2-methylidene-3-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pent-4-enoate |
|---|---|
| PubChem CID | 134462045 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | ethyl (Z)-4-(3-chloroanilino)oxy-2-methylidene-3-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)pent-4-enoate |
| SMILES | C=C(C(=O)OCC)C(=O)/C(=C/c1c[nH]c2ncccc12)ONc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H18ClN3O4/c1-3-28-21(27)13(2)19(26)18(29-25-16-7-4-6-15(22)11-16)10-14-12-24-20-17(14)8-5-9-23-20/h4-12,25H,2-3H2,1H3,(H,23,24)/b18-10- |
| InChIKey | FAEVNMFVDPCOND-ZDLGFXPLSA-N |
| XLogP | 4.29 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|