C21H19F3N4O2 — CID 134463462
2-formyl-1-[2-[N-methyl-4-(trifluoromethyl)anilino]ethyl]-N-pyridin-3-ylpyrrole-3-carboxamide (PubChem CID 134463462) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-formyl-1-[2-[N-methyl-4-(trifluoromethyl)anilino]ethyl]-N-pyridin-3-ylpyrrole-3-carboxamide.
| Compound Name | 2-formyl-1-[2-[N-methyl-4-(trifluoromethyl)anilino]ethyl]-N-pyridin-3-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 134463462 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-formyl-1-[2-[N-methyl-4-(trifluoromethyl)anilino]ethyl]-N-pyridin-3-ylpyrrole-3-carboxamide |
| SMILES | CN(CCn1ccc(C(=O)Nc2cccnc2)c1C=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N4O2/c1-27(17-6-4-15(5-7-17)21(22,23)24)11-12-28-10-8-18(19(28)14-29)20(30)26-16-3-2-9-25-13-16/h2-10,13-14H,11-12H2,1H3,(H,26,30) |
| InChIKey | SCANPGPMZORFBL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|