C22H26N4O3 — CID 134466872
(2R,3S,4R)-4-[[benzyl(hydroxy)amino]methyl]-4-methyl-2-[(4-phenyltriazol-1-yl)methyl]oxolan-3-ol (PubChem CID 134466872) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is (2R,3S,4R)-4-[[benzyl(hydroxy)amino]methyl]-4-methyl-2-[(4-phenyltriazol-1-yl)methyl]oxolan-3-ol.
| Compound Name | (2R,3S,4R)-4-[[benzyl(hydroxy)amino]methyl]-4-methyl-2-[(4-phenyltriazol-1-yl)methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 134466872 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (2R,3S,4R)-4-[[benzyl(hydroxy)amino]methyl]-4-methyl-2-[(4-phenyltriazol-1-yl)methyl]oxolan-3-ol |
| SMILES | C[C@@]1(CN(O)Cc2ccccc2)CO[C@H](Cn2cc(-c3ccccc3)nn2)[C@H]1O |
| InChI | InChI=1S/C22H26N4O3/c1-22(15-26(28)12-17-8-4-2-5-9-17)16-29-20(21(22)27)14-25-13-19(23-24-25)18-10-6-3-7-11-18/h2-11,13,20-21,27-28H,12,14-16H2,1H3/t20-,21-,22-/m1/s1 |
| InChIKey | PZWSSVHZLHDUAH-YPAWHYETSA-N |
| XLogP | 2.60 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|