C22H23FN4O — CID 134471425
cyclopropyl-[4-[2-(3-fluorobenzenecarboximidoyl)benzenecarboximidoyl]piperazin-1-yl]methanone (PubChem CID 134471425) has the molecular formula C22H23FN4O and a molecular weight of 378.45 g/mol. Its IUPAC name is cyclopropyl-[4-[2-(3-fluorobenzenecarboximidoyl)benzenecarboximidoyl]piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[2-(3-fluorobenzenecarboximidoyl)benzenecarboximidoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134471425 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | cyclopropyl-[4-[2-(3-fluorobenzenecarboximidoyl)benzenecarboximidoyl]piperazin-1-yl]methanone |
| SMILES | [H]/N=C(/c1ccccc1/C(=N/[H])c1cccc(F)c1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C22H23FN4O/c23-17-5-3-4-16(14-17)20(24)18-6-1-2-7-19(18)21(25)26-10-12-27(13-11-26)22(28)15-8-9-15/h1-7,14-15,24-25H,8-13H2/b24-20+,25-21- |
| InChIKey | HBEAVECGZIGFPP-AIMKKSDKSA-N |
| XLogP | 3.12 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|