C15H17F3O4 — CID 134471715
ethyl 6,6,6-trifluoro-5-hydroxy-5-(4-methylphenyl)-3-oxohexanoate (PubChem CID 134471715) has the molecular formula C15H17F3O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is ethyl 6,6,6-trifluoro-5-hydroxy-5-(4-methylphenyl)-3-oxohexanoate.
| Compound Name | ethyl 6,6,6-trifluoro-5-hydroxy-5-(4-methylphenyl)-3-oxohexanoate |
|---|---|
| PubChem CID | 134471715 |
| Molecular Formula | C15H17F3O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | ethyl 6,6,6-trifluoro-5-hydroxy-5-(4-methylphenyl)-3-oxohexanoate |
| SMILES | CCOC(=O)CC(=O)CC(O)(c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H17F3O4/c1-3-22-13(20)8-12(19)9-14(21,15(16,17)18)11-6-4-10(2)5-7-11/h4-7,21H,3,8-9H2,1-2H3 |
| InChIKey | NPOJGKABUACRJN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|