C13H13F6NO2 — CID 137362955
ethyl 3-(4-aminophenyl)-4,4,4-trifluoro-3-(trifluoromethyl)butanoate (PubChem CID 137362955) has the molecular formula C13H13F6NO2 and a molecular weight of 329.24 g/mol. Its IUPAC name is ethyl 3-(4-aminophenyl)-4,4,4-trifluoro-3-(trifluoromethyl)butanoate.
| Compound Name | ethyl 3-(4-aminophenyl)-4,4,4-trifluoro-3-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 137362955 |
| Molecular Formula | C13H13F6NO2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | ethyl 3-(4-aminophenyl)-4,4,4-trifluoro-3-(trifluoromethyl)butanoate |
| SMILES | CCOC(=O)CC(c1ccc(N)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F6NO2/c1-2-22-10(21)7-11(12(14,15)16,13(17,18)19)8-3-5-9(20)6-4-8/h3-6H,2,7,20H2,1H3 |
| InChIKey | LZXKZTQMOOKAAR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|