C17H13N3S — CID 134472341
2-dibenzothiophen-4-yl-4,6-dimethyl-1,3,5-triazine (PubChem CID 134472341) has the molecular formula C17H13N3S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-dibenzothiophen-4-yl-4,6-dimethyl-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-4-yl-4,6-dimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134472341 |
| Molecular Formula | C17H13N3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-dibenzothiophen-4-yl-4,6-dimethyl-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(-c2cccc3c2sc2ccccc23)n1 |
| InChI | InChI=1S/C17H13N3S/c1-10-18-11(2)20-17(19-10)14-8-5-7-13-12-6-3-4-9-15(12)21-16(13)14/h3-9H,1-2H3 |
| InChIKey | NMVKSVSUYRAUBU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |