C16H10IN3S — CID 170186944
2-dibenzothiophen-4-yl-4-iodo-6-methyl-1,3,5-triazine (PubChem CID 170186944) has the molecular formula C16H10IN3S and a molecular weight of 403.25 g/mol. Its IUPAC name is 2-dibenzothiophen-4-yl-4-iodo-6-methyl-1,3,5-triazine.
| Compound Name | 2-dibenzothiophen-4-yl-4-iodo-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170186944 |
| Molecular Formula | C16H10IN3S |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | 2-dibenzothiophen-4-yl-4-iodo-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(I)nc(-c2cccc3c2sc2ccccc23)n1 |
| InChI | InChI=1S/C16H10IN3S/c1-9-18-15(20-16(17)19-9)12-7-4-6-11-10-5-2-3-8-13(10)21-14(11)12/h2-8H,1H3 |
| InChIKey | AJDJBYYIBLMKJF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|