C17H22ClFN2O — CID 134479372
8-amino-2-[(2-chloro-4-fluorophenyl)methyl]-3-methyl-2-azaspiro[4.5]decan-1-one (PubChem CID 134479372) has the molecular formula C17H22ClFN2O and a molecular weight of 324.83 g/mol. Its IUPAC name is 8-amino-2-[(2-chloro-4-fluorophenyl)methyl]-3-methyl-2-azaspiro[4.5]decan-1-one.
| Compound Name | 8-amino-2-[(2-chloro-4-fluorophenyl)methyl]-3-methyl-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 134479372 |
| Molecular Formula | C17H22ClFN2O |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 8-amino-2-[(2-chloro-4-fluorophenyl)methyl]-3-methyl-2-azaspiro[4.5]decan-1-one |
| SMILES | CC1CC2(CCC(N)CC2)C(=O)N1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H22ClFN2O/c1-11-9-17(6-4-14(20)5-7-17)16(22)21(11)10-12-2-3-13(19)8-15(12)18/h2-3,8,11,14H,4-7,9-10,20H2,1H3 |
| InChIKey | KRJJTMNGGJEAEI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |