C17H21ClFNO2 — CID 134479416
2-[(2-chloro-4-fluorophenyl)methyl]-8-hydroxy-3-methyl-2-azaspiro[4.5]decan-1-one (PubChem CID 134479416) has the molecular formula C17H21ClFNO2 and a molecular weight of 325.81 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl]-8-hydroxy-3-methyl-2-azaspiro[4.5]decan-1-one.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl]-8-hydroxy-3-methyl-2-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 134479416 |
| Molecular Formula | C17H21ClFNO2 |
| Molecular Weight | 325.81 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl]-8-hydroxy-3-methyl-2-azaspiro[4.5]decan-1-one |
| SMILES | CC1CC2(CCC(O)CC2)C(=O)N1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H21ClFNO2/c1-11-9-17(6-4-14(21)5-7-17)16(22)20(11)10-12-2-3-13(19)8-15(12)18/h2-3,8,11,14,21H,4-7,9-10H2,1H3 |
| InChIKey | ZCKLUZPDVTUYOF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |