C29H22F8O — CID 134479594
5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorocyclohexa-1,3-dien-1-yl]-5-fluorocyclohexa-1,3-dien-1-yl]-2-methyl-2,3-dihydro-1H-indene (PubChem CID 134479594) has the molecular formula C29H22F8O and a molecular weight of 538.48 g/mol. Its IUPAC name is 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorocyclohexa-1,3-dien-1-yl]-5-fluorocyclohexa-1,3-dien-1-yl]-2-methyl-2,3-dihydro-1H-indene.
| Compound Name | 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorocyclohexa-1,3-dien-1-yl]-5-fluorocyclohexa-1,3-dien-1-yl]-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 134479594 |
| Molecular Formula | C29H22F8O |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 5-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorocyclohexa-1,3-dien-1-yl]-5-fluorocyclohexa-1,3-dien-1-yl]-2-methyl-2,3-dihydro-1H-indene |
| SMILES | CC1Cc2ccc(C3=CC=C(C4=CC(F)=C(C(F)(F)Oc5cc(F)c(F)c(F)c5)C(F)C4)C(F)C3)cc2C1 |
| InChI | InChI=1S/C29H22F8O/c1-14-6-15-2-3-16(8-18(15)7-14)17-4-5-21(22(30)9-17)19-10-23(31)27(24(32)11-19)29(36,37)38-20-12-25(33)28(35)26(34)13-20/h2-5,8,10,12-14,22,24H,6-7,9,11H2,1H3 |
| InChIKey | PGIDMQIKHPXOFE-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|