C25H15F9O — CID 123207647
5-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,2-difluoroethenyl]-2-methyl-2,3-dihydro-1H-indene (PubChem CID 123207647) has the molecular formula C25H15F9O and a molecular weight of 502.38 g/mol. Its IUPAC name is 5-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,2-difluoroethenyl]-2-methyl-2,3-dihydro-1H-indene.
| Compound Name | 5-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,2-difluoroethenyl]-2-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 123207647 |
| Molecular Formula | C25H15F9O |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 5-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-1,2-difluoroethenyl]-2-methyl-2,3-dihydro-1H-indene |
| SMILES | CC1Cc2ccc(C(F)=C(F)c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)cc2C1 |
| InChI | InChI=1S/C25H15F9O/c1-11-4-12-2-3-13(6-14(12)5-11)22(30)23(31)15-7-17(26)21(18(27)8-15)25(33,34)35-16-9-19(28)24(32)20(29)10-16/h2-3,6-11H,4-5H2,1H3 |
| InChIKey | UCYDAJWLPPCKAY-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|