C29H40N2O3 — CID 134482114
2-[1-[(6R,9S)-7-cyclodecyl-7-azabicyclo[4.2.2]decan-9-yl]indol-3-yl]-2-oxoacetic acid (PubChem CID 134482114) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is 2-[1-[(6R,9S)-7-cyclodecyl-7-azabicyclo[4.2.2]decan-9-yl]indol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[1-[(6R,9S)-7-cyclodecyl-7-azabicyclo[4.2.2]decan-9-yl]indol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 134482114 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 2-[1-[(6R,9S)-7-cyclodecyl-7-azabicyclo[4.2.2]decan-9-yl]indol-3-yl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1cn([C@H]2C[C@H]3CCCCC2CN3C2CCCCCCCCC2)c2ccccc12 |
| InChI | InChI=1S/C29H40N2O3/c32-28(29(33)34)25-20-31(26-17-11-10-16-24(25)26)27-18-23-15-9-8-12-21(27)19-30(23)22-13-6-4-2-1-3-5-7-14-22/h10-11,16-17,20-23,27H,1-9,12-15,18-19H2,(H,33,34)/t21?,23-,27+/m1/s1 |
| InChIKey | DMNUYVLKAFAHOA-QHGYMGQKSA-N |
| XLogP | 6.61 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|