C32H48N2O3 — CID 144657401
ethane;methyl 2-[1-(9-cyclodecyl-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indol-3-yl]-2-oxoacetate (PubChem CID 144657401) has the molecular formula C32H48N2O3 and a molecular weight of 508.75 g/mol. Its IUPAC name is ethane;methyl 2-[1-(9-cyclodecyl-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indol-3-yl]-2-oxoacetate.
| Compound Name | ethane;methyl 2-[1-(9-cyclodecyl-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indol-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 144657401 |
| Molecular Formula | C32H48N2O3 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.37 |
| IUPAC Name | ethane;methyl 2-[1-(9-cyclodecyl-6-methyl-9-azabicyclo[3.3.1]nonan-3-yl)indol-3-yl]-2-oxoacetate |
| SMILES | CC.COC(=O)C(=O)c1cn(C2CC3CCC(C)C(C2)N3C2CCCCCCCCC2)c2ccccc12 |
| InChI | InChI=1S/C30H42N2O3.C2H6/c1-21-16-17-23-18-24(19-28(21)32(23)22-12-8-6-4-3-5-7-9-13-22)31-20-26(29(33)30(34)35-2)25-14-10-11-15-27(25)31;1-2/h10-11,14-15,20-24,28H,3-9,12-13,16-19H2,1-2H3;1-2H3 |
| InChIKey | LYQAHSOREDGMON-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|