C21H21NO10 — CID 40580804
2-oxo-2-[1-[(2S,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]indol-3-yl]acetic acid (PubChem CID 40580804) has the molecular formula C21H21NO10 and a molecular weight of 447.40 g/mol. Its IUPAC name is 2-oxo-2-[1-[(2S,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]indol-3-yl]acetic acid.
| Compound Name | 2-oxo-2-[1-[(2S,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 40580804 |
| Molecular Formula | C21H21NO10 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 2-oxo-2-[1-[(2S,3R,4R,5R)-3,4,5-triacetyloxyoxan-2-yl]indol-3-yl]acetic acid |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)CO[C@@H]1n1cc(C(=O)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C21H21NO10/c1-10(23)30-16-9-29-20(19(32-12(3)25)18(16)31-11(2)24)22-8-14(17(26)21(27)28)13-6-4-5-7-15(13)22/h4-8,16,18-20H,9H2,1-3H3,(H,27,28)/t16-,18-,19-,20+/m1/s1 |
| InChIKey | GKASZHXFBQGIKI-AFYVEPGGSA-N |
| XLogP | 1.23 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|