C19H20BrNO7 — CID 23267754
[(3S,4S,5R,6R)-4,5-diacetyloxy-6-(5-bromoindol-1-yl)oxan-3-yl] acetate (PubChem CID 23267754) has the molecular formula C19H20BrNO7 and a molecular weight of 454.27 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(5-bromoindol-1-yl)oxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(5-bromoindol-1-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 23267754 |
| Molecular Formula | C19H20BrNO7 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(5-bromoindol-1-yl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](n2ccc3cc(Br)ccc32)OC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H20BrNO7/c1-10(22)26-16-9-25-19(18(28-12(3)24)17(16)27-11(2)23)21-7-6-13-8-14(20)4-5-15(13)21/h4-8,16-19H,9H2,1-3H3/t16-,17-,18+,19+/m0/s1 |
| InChIKey | IFZQHUGJEWOYJI-INDMIFKZSA-N |
| XLogP | 2.73 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|