C21H25NO8 — CID 23267847
[(3S,4S,5R,6R)-6-(5-acetyl-2,3-dihydroindol-1-yl)-4,5-diacetyloxyoxan-3-yl] acetate (PubChem CID 23267847) has the molecular formula C21H25NO8 and a molecular weight of 419.43 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-6-(5-acetyl-2,3-dihydroindol-1-yl)-4,5-diacetyloxyoxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-6-(5-acetyl-2,3-dihydroindol-1-yl)-4,5-diacetyloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 23267847 |
| Molecular Formula | C21H25NO8 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [(3S,4S,5R,6R)-6-(5-acetyl-2,3-dihydroindol-1-yl)-4,5-diacetyloxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](N2CCc3cc(C(C)=O)ccc32)OC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H25NO8/c1-11(23)15-5-6-17-16(9-15)7-8-22(17)21-20(30-14(4)26)19(29-13(3)25)18(10-27-21)28-12(2)24/h5-6,9,18-21H,7-8,10H2,1-4H3/t18-,19-,20+,21+/m0/s1 |
| InChIKey | BUBZLXHABLZWGR-UWHLTILDSA-N |
| XLogP | 1.40 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|