C19H21BrN2O9 — CID 129439996
[(3R,4S,5S,6S)-4,5-diacetyloxy-6-(5-bromo-6-nitro-2,3-dihydroindol-1-yl)oxan-3-yl] acetate (PubChem CID 129439996) has the molecular formula C19H21BrN2O9 and a molecular weight of 501.29 g/mol. Its IUPAC name is [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(5-bromo-6-nitro-2,3-dihydroindol-1-yl)oxan-3-yl] acetate.
| Compound Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(5-bromo-6-nitro-2,3-dihydroindol-1-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 129439996 |
| Molecular Formula | C19H21BrN2O9 |
| Molecular Weight | 501.29 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | [(3R,4S,5S,6S)-4,5-diacetyloxy-6-(5-bromo-6-nitro-2,3-dihydroindol-1-yl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](N2CCc3cc(Br)c([N+](=O)[O-])cc32)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H21BrN2O9/c1-9(23)29-16-8-28-19(18(31-11(3)25)17(16)30-10(2)24)21-5-4-12-6-13(20)15(22(26)27)7-14(12)21/h6-7,16-19H,4-5,8H2,1-3H3/t16-,17+,18+,19+/m1/s1 |
| InChIKey | PXOPQAZZHOFEKR-XWSJACJDSA-N |
| XLogP | 1.87 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|