C24H24F6N4 — CID 134484425
4-methyl-1-(3-methylimidazo[4,5-f]quinolin-2-yl)-N-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]hexan-3-imine (PubChem CID 134484425) has the molecular formula C24H24F6N4 and a molecular weight of 482.47 g/mol. Its IUPAC name is 4-methyl-1-(3-methylimidazo[4,5-f]quinolin-2-yl)-N-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]hexan-3-imine.
| Compound Name | 4-methyl-1-(3-methylimidazo[4,5-f]quinolin-2-yl)-N-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]hexan-3-imine |
|---|---|
| PubChem CID | 134484425 |
| Molecular Formula | C24H24F6N4 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 4-methyl-1-(3-methylimidazo[4,5-f]quinolin-2-yl)-N-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]hexan-3-imine |
| SMILES | C=C(/C=C(\N=C(/CCc1nc2c3cccnc3ccc2n1C)C(C)CC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H24F6N4/c1-5-14(2)17(32-20(24(28,29)30)13-15(3)23(25,26)27)9-11-21-33-22-16-7-6-12-31-18(16)8-10-19(22)34(21)4/h6-8,10,12-14H,3,5,9,11H2,1-2,4H3/b20-13-,32-17+ |
| InChIKey | VOJWGGCIADUXDV-JQDJWYHQSA-N |
| XLogP | 7.11 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|