C21H28NO2+ — CID 134488088
(7,8-dimethoxy-5-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)-trimethylazanium (PubChem CID 134488088) has the molecular formula C21H28NO2+ and a molecular weight of 326.46 g/mol. Its IUPAC name is (7,8-dimethoxy-5-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)-trimethylazanium.
| Compound Name | (7,8-dimethoxy-5-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)-trimethylazanium |
|---|---|
| PubChem CID | 134488088 |
| Molecular Formula | C21H28NO2+ |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (7,8-dimethoxy-5-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl)-trimethylazanium |
| SMILES | COc1cc(-c2ccccc2)c2c(c1OC)CC([N+](C)(C)C)CC2 |
| InChI | InChI=1S/C21H28NO2/c1-22(2,3)16-11-12-17-18(15-9-7-6-8-10-15)14-20(23-4)21(24-5)19(17)13-16/h6-10,14,16H,11-13H2,1-5H3/q+1 |
| InChIKey | XGUCBCTZNBIJEU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|