C18H37F2N3O — CID 134488844
N-[2,2-difluoro-3-[4-(4-propan-2-ylpiperazin-1-yl)butoxy]propyl]-2-methylpropan-2-amine (PubChem CID 134488844) has the molecular formula C18H37F2N3O and a molecular weight of 349.51 g/mol. Its IUPAC name is N-[2,2-difluoro-3-[4-(4-propan-2-ylpiperazin-1-yl)butoxy]propyl]-2-methylpropan-2-amine.
| Compound Name | N-[2,2-difluoro-3-[4-(4-propan-2-ylpiperazin-1-yl)butoxy]propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 134488844 |
| Molecular Formula | C18H37F2N3O |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.29 |
| IUPAC Name | N-[2,2-difluoro-3-[4-(4-propan-2-ylpiperazin-1-yl)butoxy]propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)N1CCN(CCCCOCC(F)(F)CNC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H37F2N3O/c1-16(2)23-11-9-22(10-12-23)8-6-7-13-24-15-18(19,20)14-21-17(3,4)5/h16,21H,6-15H2,1-5H3 |
| InChIKey | LFWRYRWKJWZZIC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|