C16H33F2N3O — CID 134492953
N-[2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]propyl]-2-methylpropan-2-amine (PubChem CID 134492953) has the molecular formula C16H33F2N3O and a molecular weight of 321.46 g/mol. Its IUPAC name is N-[2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]propyl]-2-methylpropan-2-amine.
| Compound Name | N-[2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 134492953 |
| Molecular Formula | C16H33F2N3O |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | N-[2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]propyl]-2-methylpropan-2-amine |
| SMILES | CN1CCN(CCCCOCC(F)(F)CNC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H33F2N3O/c1-15(2,3)19-13-16(17,18)14-22-12-6-5-7-21-10-8-20(4)9-11-21/h19H,5-14H2,1-4H3 |
| InChIKey | JCCHAWXEHQPSKF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|