C14H31F2N3O — CID 142386155
2,2-difluoro-N-methyl-3-(4-piperazin-1-ylbutoxy)propan-1-amine;ethane (PubChem CID 142386155) has the molecular formula C14H31F2N3O and a molecular weight of 295.42 g/mol. Its IUPAC name is 2,2-difluoro-N-methyl-3-(4-piperazin-1-ylbutoxy)propan-1-amine;ethane.
| Compound Name | 2,2-difluoro-N-methyl-3-(4-piperazin-1-ylbutoxy)propan-1-amine;ethane |
|---|---|
| PubChem CID | 142386155 |
| Molecular Formula | C14H31F2N3O |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | 2,2-difluoro-N-methyl-3-(4-piperazin-1-ylbutoxy)propan-1-amine;ethane |
| SMILES | CC.CNCC(F)(F)COCCCCN1CCNCC1 |
| InChI | InChI=1S/C12H25F2N3O.C2H6/c1-15-10-12(13,14)11-18-9-3-2-6-17-7-4-16-5-8-17;1-2/h15-16H,2-11H2,1H3;1-2H3 |
| InChIKey | SEUTYIITBDDTEI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|