C14H28F2IN3O2 — CID 142364921
2,2-difluoro-N-iodo-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]propan-1-amine (PubChem CID 142364921) has the molecular formula C14H28F2IN3O2 and a molecular weight of 435.30 g/mol. Its IUPAC name is 2,2-difluoro-N-iodo-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]propan-1-amine.
| Compound Name | 2,2-difluoro-N-iodo-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]propan-1-amine |
|---|---|
| PubChem CID | 142364921 |
| Molecular Formula | C14H28F2IN3O2 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2,2-difluoro-N-iodo-3-[4-[4-(2-methoxyethyl)piperazin-1-yl]butoxy]propan-1-amine |
| SMILES | COCCN1CCN(CCCCOCC(F)(F)CNI)CC1 |
| InChI | InChI=1S/C14H28F2IN3O2/c1-21-11-9-20-7-5-19(6-8-20)4-2-3-10-22-13-14(15,16)12-18-17/h18H,2-13H2,1H3 |
| InChIKey | KIPJNDICMGFKQT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|