C24H22F8N2O3S — CID 134491464
1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-3-methylurea (PubChem CID 134491464) has the molecular formula C24H22F8N2O3S and a molecular weight of 570.50 g/mol. Its IUPAC name is 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-3-methylurea.
| Compound Name | 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-3-methylurea |
|---|---|
| PubChem CID | 134491464 |
| Molecular Formula | C24H22F8N2O3S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 1-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]-3-methylurea |
| SMILES | CNC(=O)N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C24H22F8N2O3S/c1-33-20(35)34-19-10-11-21(38(36,37)16-6-4-15(25)5-7-16)17-9-3-14(12-13(17)2-8-18(19)21)22(26,23(27,28)29)24(30,31)32/h3-7,9,12,18-19H,2,8,10-11H2,1H3,(H2,33,34,35)/t18-,19+,21+/m0/s1 |
| InChIKey | PKHDPGAMOUIIJK-QKNQBKEWSA-N |
| XLogP | 5.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |