C23H21F8NO4S2 — CID 134491434
N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]methanesulfonamide (PubChem CID 134491434) has the molecular formula C23H21F8NO4S2 and a molecular weight of 591.54 g/mol. Its IUPAC name is N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]methanesulfonamide.
| Compound Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 134491434 |
| Molecular Formula | C23H21F8NO4S2 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | N-[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C23H21F8NO4S2/c1-37(33,34)32-19-10-11-20(38(35,36)16-6-4-15(24)5-7-16)17-9-3-14(12-13(17)2-8-18(19)20)21(25,22(26,27)28)23(29,30)31/h3-7,9,12,18-19,32H,2,8,10-11H2,1H3/t18-,19+,20+/m0/s1 |
| InChIKey | YRBQTCAXHJRSEO-XUVXKRRUSA-N |
| XLogP | 5.06 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |