C27H24F3N5O5S — CID 134492963
3-[6-[3-[4-(4-nitrososulfanylpiperidin-1-yl)-6-(trifluoromethyl)-2-pyridinyl]prop-2-ynoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 134492963) has the molecular formula C27H24F3N5O5S and a molecular weight of 587.58 g/mol. Its IUPAC name is 3-[6-[3-[4-(4-nitrososulfanylpiperidin-1-yl)-6-(trifluoromethyl)-2-pyridinyl]prop-2-ynoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-[4-(4-nitrososulfanylpiperidin-1-yl)-6-(trifluoromethyl)-2-pyridinyl]prop-2-ynoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134492963 |
| Molecular Formula | C27H24F3N5O5S |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | 3-[6-[3-[4-(4-nitrososulfanylpiperidin-1-yl)-6-(trifluoromethyl)-2-pyridinyl]prop-2-ynoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=NSC1CCN(c2cc(C#CCOc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H24F3N5O5S/c28-27(29,30)23-14-18(34-9-7-20(8-10-34)41-33-39)13-17(31-23)2-1-11-40-19-3-4-21-16(12-19)15-35(26(21)38)22-5-6-24(36)32-25(22)37/h3-4,12-14,20,22H,5-11,15H2,(H,32,36,37) |
| InChIKey | AZOZFWWKJQMIFV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|