About tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate
tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 134498151) has the molecular formula C21H28N4O4
and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| PubChem CID | 134498151 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)c1cnn(CCc2ccc3c(n2)N(C(=O)OC(C)(C)C)CCC3)c1 |
| InChI | InChI=1S/C21H28N4O4/c1-5-28-19(26)16-13-22-24(14-16)12-10-17-9-8-15-7-6-11-25(18(15)23-17)20(27)29-21(2,3)4/h8-9,13-14H,5-7,10-12H2,1-4H3 |
| InChIKey | ARNCQSJIKRZGQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate?
The IUPAC name of tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (CID 134498151) is tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
What is the SMILES notation for tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate?
The canonical SMILES for tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate is CCOC(=O)c1cnn(CCc2ccc3c(n2)N(C(=O)OC(C)(C)C)CCC3)c1.
What is the InChIKey of tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate?
The InChIKey is ARNCQSJIKRZGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N4O4/c1-5-28-19(26)16-13-22-24(14-16)12-10-17-9-8-15-7-6-11-25(18(15)23-17)20(27)29-21(2,3)4/h8-9,13-14H,5-7,10-12H2,1-4H3.
What are the key properties of tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate?
tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate has a molecular weight of 400.48 g/mol, XLogP of 3.39, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-[2-(4-ethoxycarbonylpyrazol-1-yl)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate is sourced from PubChem (CID 134498151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).