C14H23N6O2+ — CID 134499790
1-methyl-5-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrazole-4-diazonium (PubChem CID 134499790) has the molecular formula C14H23N6O2+ and a molecular weight of 307.38 g/mol. Its IUPAC name is 1-methyl-5-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrazole-4-diazonium.
| Compound Name | 1-methyl-5-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrazole-4-diazonium |
|---|---|
| PubChem CID | 134499790 |
| Molecular Formula | C14H23N6O2+ |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-methyl-5-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrazole-4-diazonium |
| SMILES | CC1CN(c2c([N+]#N)cnn2C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23N6O2/c1-10-9-19(12-11(17-15)8-16-18(12)5)6-7-20(10)13(21)22-14(2,3)4/h8,10H,6-7,9H2,1-5H3/q+1 |
| InChIKey | PMVPKOLTGKJMNC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|