C14H24N4O2 — CID 134500707
tert-butyl (2S)-2-methyl-4-(2-methylpyrazol-3-yl)piperazine-1-carboxylate (PubChem CID 134500707) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-4-(2-methylpyrazol-3-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-methyl-4-(2-methylpyrazol-3-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134500707 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | tert-butyl (2S)-2-methyl-4-(2-methylpyrazol-3-yl)piperazine-1-carboxylate |
| SMILES | C[C@H]1CN(c2ccnn2C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N4O2/c1-11-10-17(12-6-7-15-16(12)5)8-9-18(11)13(19)20-14(2,3)4/h6-7,11H,8-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | DPIBHJBUDSMIIL-NSHDSACASA-N |
| XLogP | 1.87 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |