C17H28N4 — CID 134503074
1-[2-(piperidin-1-ylmethylamino)ethyl]-3,4-dihydro-2H-quinolin-7-amine (PubChem CID 134503074) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-[2-(piperidin-1-ylmethylamino)ethyl]-3,4-dihydro-2H-quinolin-7-amine.
| Compound Name | 1-[2-(piperidin-1-ylmethylamino)ethyl]-3,4-dihydro-2H-quinolin-7-amine |
|---|---|
| PubChem CID | 134503074 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-[2-(piperidin-1-ylmethylamino)ethyl]-3,4-dihydro-2H-quinolin-7-amine |
| SMILES | Nc1ccc2c(c1)N(CCNCN1CCCCC1)CCC2 |
| InChI | InChI=1S/C17H28N4/c18-16-7-6-15-5-4-11-21(17(15)13-16)12-8-19-14-20-9-2-1-3-10-20/h6-7,13,19H,1-5,8-12,14,18H2 |
| InChIKey | ZIXRPASIOOFONG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|